C22H37NO3 — CID 98126446
1-[2-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]-4,6-dimethylphenyl]octan-1-one (PubChem CID 98126446) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 1-[2-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]-4,6-dimethylphenyl]octan-1-one.
| Compound Name | 1-[2-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]-4,6-dimethylphenyl]octan-1-one |
|---|---|
| PubChem CID | 98126446 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 1-[2-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]-4,6-dimethylphenyl]octan-1-one |
| SMILES | CCCCCCCC(=O)c1c(C)cc(C)cc1OC[C@H](O)CNC(C)C |
| InChI | InChI=1S/C22H37NO3/c1-6-7-8-9-10-11-20(25)22-18(5)12-17(4)13-21(22)26-15-19(24)14-23-16(2)3/h12-13,16,19,23-24H,6-11,14-15H2,1-5H3/t19-/m1/s1 |
| InChIKey | GRTPFCLIFDQQAH-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|