C34H57NO4 — CID 70496276
1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;octadecanoic acid (PubChem CID 70496276) has the molecular formula C34H57NO4 and a molecular weight of 543.83 g/mol. Its IUPAC name is 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;octadecanoic acid.
| Compound Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;octadecanoic acid |
|---|---|
| PubChem CID | 70496276 |
| Molecular Formula | C34H57NO4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 543.43 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;octadecanoic acid |
| SMILES | CC(C)NCC(O)COc1cccc2ccccc12.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C16H21NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h2-17H2,1H3,(H,19,20);3-9,12,14,17-18H,10-11H2,1-2H3 |
| InChIKey | UIPYXAJTFDIDDN-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|