C19H27Cl2NO3 — CID 172990289
1-(1-chloro-3-naphthalen-1-yloxypropan-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 172990289) has the molecular formula C19H27Cl2NO3 and a molecular weight of 388.34 g/mol. Its IUPAC name is 1-(1-chloro-3-naphthalen-1-yloxypropan-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(1-chloro-3-naphthalen-1-yloxypropan-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 172990289 |
| Molecular Formula | C19H27Cl2NO3 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(1-chloro-3-naphthalen-1-yloxypropan-2-yl)oxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)NCC(O)COC(CCl)COc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C19H26ClNO3.ClH/c1-14(2)21-11-16(22)12-23-17(10-20)13-24-19-9-5-7-15-6-3-4-8-18(15)19;/h3-9,14,16-17,21-22H,10-13H2,1-2H3;1H |
| InChIKey | OIFHNMPNRHOPLH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|