C18H27NO3 — CID 174932203
ethanol;1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol (PubChem CID 174932203) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethanol;1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | ethanol;1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 174932203 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethanol;1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1cccc2ccccc12.CCO |
| InChI | InChI=1S/C16H21NO2.C2H6O/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;1-2-3/h3-9,12,14,17-18H,10-11H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YGGNQSYGHPSHBX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |