C23H28ClNO2 — CID 138958899
1-[1-(4-ethylphenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride (PubChem CID 138958899) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride.
| Compound Name | 1-[1-(4-ethylphenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138958899 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[1-(4-ethylphenyl)ethylamino]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
| SMILES | CCc1ccc(C(C)NCC(O)COc2cccc3ccccc23)cc1.Cl |
| InChI | InChI=1S/C23H27NO2.ClH/c1-3-18-11-13-19(14-12-18)17(2)24-15-21(25)16-26-23-10-6-8-20-7-4-5-9-22(20)23;/h4-14,17,21,24-25H,3,15-16H2,1-2H3;1H |
| InChIKey | HPYSFGVGBQXAQP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |