C20H27NO2 — CID 112768289
1-[1-(4-ethylphenyl)ethylamino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 112768289) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)ethylamino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[1-(4-ethylphenyl)ethylamino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 112768289 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-[1-(4-ethylphenyl)ethylamino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | CCc1ccc(C(C)NCC(O)COc2ccccc2C)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-4-17-9-11-18(12-10-17)16(3)21-13-19(22)14-23-20-8-6-5-7-15(20)2/h5-12,16,19,21-22H,4,13-14H2,1-3H3 |
| InChIKey | BLKRTEVRBAMTAF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |