C17H19Cl2NO2 — CID 112768285
1-(2-chlorophenoxy)-3-[1-(4-chlorophenyl)ethylamino]propan-2-ol (PubChem CID 112768285) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-[1-(4-chlorophenyl)ethylamino]propan-2-ol.
| Compound Name | 1-(2-chlorophenoxy)-3-[1-(4-chlorophenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 112768285 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-[1-(4-chlorophenyl)ethylamino]propan-2-ol |
| SMILES | CC(NCC(O)COc1ccccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO2/c1-12(13-6-8-14(18)9-7-13)20-10-15(21)11-22-17-5-3-2-4-16(17)19/h2-9,12,15,20-21H,10-11H2,1H3 |
| InChIKey | SIBXIEHWZAUNEE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |