C13H20ClNO3 — CID 2141740
(2R)-2-[[(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butan-1-ol (PubChem CID 2141740) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is (2R)-2-[[(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butan-1-ol.
| Compound Name | (2R)-2-[[(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 2141740 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2R)-2-[[(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]amino]butan-1-ol |
| SMILES | CC[C@H](CO)NC[C@@H](O)COc1ccccc1Cl |
| InChI | InChI=1S/C13H20ClNO3/c1-2-10(8-16)15-7-11(17)9-18-13-6-4-3-5-12(13)14/h3-6,10-11,15-17H,2,7-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | DBKOPMBQVCNBGL-GHMZBOCLSA-N |
| XLogP | 1.44 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |