C13H21ClNO3+ — CID 2141739
[(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]-[(2R)-1-hydroxybutan-2-yl]azanium (PubChem CID 2141739) has the molecular formula C13H21ClNO3+ and a molecular weight of 274.77 g/mol. Its IUPAC name is [(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]-[(2R)-1-hydroxybutan-2-yl]azanium.
| Compound Name | [(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]-[(2R)-1-hydroxybutan-2-yl]azanium |
|---|---|
| PubChem CID | 2141739 |
| Molecular Formula | C13H21ClNO3+ |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(2R)-3-(2-chlorophenoxy)-2-hydroxypropyl]-[(2R)-1-hydroxybutan-2-yl]azanium |
| SMILES | CC[C@H](CO)[NH2+]C[C@@H](O)COc1ccccc1Cl |
| InChI | InChI=1S/C13H20ClNO3/c1-2-10(8-16)15-7-11(17)9-18-13-6-4-3-5-12(13)14/h3-6,10-11,15-17H,2,7-9H2,1H3/p+1/t10-,11-/m1/s1 |
| InChIKey | DBKOPMBQVCNBGL-GHMZBOCLSA-O |
| XLogP | 0.41 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |