C14H23BrNO2+ — CID 2502096
[(2R)-3-(4-bromophenoxy)-2-hydroxypropyl]-pentan-3-ylazanium (PubChem CID 2502096) has the molecular formula C14H23BrNO2+ and a molecular weight of 317.25 g/mol. Its IUPAC name is [(2R)-3-(4-bromophenoxy)-2-hydroxypropyl]-pentan-3-ylazanium.
| Compound Name | [(2R)-3-(4-bromophenoxy)-2-hydroxypropyl]-pentan-3-ylazanium |
|---|---|
| PubChem CID | 2502096 |
| Molecular Formula | C14H23BrNO2+ |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [(2R)-3-(4-bromophenoxy)-2-hydroxypropyl]-pentan-3-ylazanium |
| SMILES | CCC(CC)[NH2+]C[C@@H](O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrNO2/c1-3-12(4-2)16-9-13(17)10-18-14-7-5-11(15)6-8-14/h5-8,12-13,16-17H,3-4,9-10H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | ZVVQHARLDKPBTD-CYBMUJFWSA-O |
| XLogP | 1.94 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |