C18H32NO4+ — CID 36688099
[(2S)-2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylazanium (PubChem CID 36688099) has the molecular formula C18H32NO4+ and a molecular weight of 326.46 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylazanium.
| Compound Name | [(2S)-2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 36688099 |
| Molecular Formula | C18H32NO4+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]C[C@H](O)COc1ccc(COCCOC(C)C)cc1 |
| InChI | InChI=1S/C18H31NO4/c1-14(2)19-11-17(20)13-23-18-7-5-16(6-8-18)12-21-9-10-22-15(3)4/h5-8,14-15,17,19-20H,9-13H2,1-4H3/p+1/t17-/m0/s1 |
| InChIKey | VHYCDWMUTMEGQY-KRWDZBQOSA-O |
| XLogP | 1.34 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|