C17H30NO3+ — CID 7165393
[(2R)-butan-2-yl]-[(2S)-3-[2-(4-ethylphenoxy)ethoxy]-2-hydroxypropyl]azanium (PubChem CID 7165393) has the molecular formula C17H30NO3+ and a molecular weight of 296.43 g/mol. Its IUPAC name is [(2R)-butan-2-yl]-[(2S)-3-[2-(4-ethylphenoxy)ethoxy]-2-hydroxypropyl]azanium.
| Compound Name | [(2R)-butan-2-yl]-[(2S)-3-[2-(4-ethylphenoxy)ethoxy]-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7165393 |
| Molecular Formula | C17H30NO3+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(2R)-butan-2-yl]-[(2S)-3-[2-(4-ethylphenoxy)ethoxy]-2-hydroxypropyl]azanium |
| SMILES | CCc1ccc(OCCOC[C@@H](O)C[NH2+][C@H](C)CC)cc1 |
| InChI | InChI=1S/C17H29NO3/c1-4-14(3)18-12-16(19)13-20-10-11-21-17-8-6-15(5-2)7-9-17/h6-9,14,16,18-19H,4-5,10-13H2,1-3H3/p+1/t14-,16+/m1/s1 |
| InChIKey | RAVMMGYAVHCQEN-ZBFHGGJFSA-O |
| XLogP | 1.37 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|