C22H32NO4+ — CID 7998782
[(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2S)-butan-2-yl]azanium (PubChem CID 7998782) has the molecular formula C22H32NO4+ and a molecular weight of 374.50 g/mol. Its IUPAC name is [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2S)-butan-2-yl]azanium.
| Compound Name | [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2S)-butan-2-yl]azanium |
|---|---|
| PubChem CID | 7998782 |
| Molecular Formula | C22H32NO4+ |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [(2S)-3-[bis(4-methoxyphenyl)methoxy]-2-hydroxypropyl]-[(2S)-butan-2-yl]azanium |
| SMILES | CC[C@H](C)[NH2+]C[C@H](O)COC(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H31NO4/c1-5-16(2)23-14-19(24)15-27-22(17-6-10-20(25-3)11-7-17)18-8-12-21(26-4)13-9-18/h6-13,16,19,22-24H,5,14-15H2,1-4H3/p+1/t16-,19-/m0/s1 |
| InChIKey | CIBXAFWEOIRJJM-LPHOPBHVSA-O |
| XLogP | 2.53 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |