C28H35NO5 — CID 25413639
(2R)-1-[benzyl(2-methoxyethyl)amino]-3-[bis(4-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 25413639) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2R)-1-[benzyl(2-methoxyethyl)amino]-3-[bis(4-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-[benzyl(2-methoxyethyl)amino]-3-[bis(4-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 25413639 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (2R)-1-[benzyl(2-methoxyethyl)amino]-3-[bis(4-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COCCN(Cc1ccccc1)C[C@@H](O)COC(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H35NO5/c1-31-18-17-29(19-22-7-5-4-6-8-22)20-25(30)21-34-28(23-9-13-26(32-2)14-10-23)24-11-15-27(33-3)16-12-24/h4-16,25,28,30H,17-21H2,1-3H3/t25-/m1/s1 |
| InChIKey | RFIRGGAMRUWBHS-RUZDIDTESA-N |
| XLogP | 4.32 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |