C19H24FNO3 — CID 93160726
(2S)-1-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-phenoxypropan-2-ol (PubChem CID 93160726) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is (2S)-1-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93160726 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-1-[(4-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-phenoxypropan-2-ol |
| SMILES | COCCN(Cc1ccc(F)cc1)C[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C19H24FNO3/c1-23-12-11-21(13-16-7-9-17(20)10-8-16)14-18(22)15-24-19-5-3-2-4-6-19/h2-10,18,22H,11-15H2,1H3/t18-/m0/s1 |
| InChIKey | QBJZKZWLWQUOLL-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |