C21H28FNO3 — CID 46006806
1-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenylmethoxypropan-2-ol (PubChem CID 46006806) has the molecular formula C21H28FNO3 and a molecular weight of 361.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 46006806 |
| Molecular Formula | C21H28FNO3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenylmethoxypropan-2-ol |
| SMILES | COCCCN(Cc1ccc(F)cc1)CC(O)COCc1ccccc1 |
| InChI | InChI=1S/C21H28FNO3/c1-25-13-5-12-23(14-18-8-10-20(22)11-9-18)15-21(24)17-26-16-19-6-3-2-4-7-19/h2-4,6-11,21,24H,5,12-17H2,1H3 |
| InChIKey | AKYVZTAIIYHVBV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|