C20H29NO4 — CID 24713531
1-[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]-3-phenylmethoxypropan-2-ol (PubChem CID 24713531) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is 1-[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 24713531 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]-3-phenylmethoxypropan-2-ol |
| SMILES | COCCCN(Cc1ccc(C)o1)CC(O)COCc1ccccc1 |
| InChI | InChI=1S/C20H29NO4/c1-17-9-10-20(25-17)14-21(11-6-12-23-2)13-19(22)16-24-15-18-7-4-3-5-8-18/h3-5,7-10,19,22H,6,11-16H2,1-2H3 |
| InChIKey | WJUXEGVXGCFGBP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|