C21H31NO4 — CID 42682220
1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 42682220) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 42682220 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | COCCCN(Cc1cc(C)ccc1C)CC(O)COCc1ccco1 |
| InChI | InChI=1S/C21H31NO4/c1-17-7-8-18(2)19(12-17)13-22(9-5-10-24-3)14-20(23)15-25-16-21-6-4-11-26-21/h4,6-8,11-12,20,23H,5,9-10,13-16H2,1-3H3 |
| InChIKey | RJZPZDTTZWYKOH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|