C23H33NO3 — CID 42682221
1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 42682221) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 42682221 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | COCCCN(Cc1cc(C)ccc1C)CC(O)COc1ccccc1C |
| InChI | InChI=1S/C23H33NO3/c1-18-10-11-19(2)21(14-18)15-24(12-7-13-26-4)16-22(25)17-27-23-9-6-5-8-20(23)3/h5-6,8-11,14,22,25H,7,12-13,15-17H2,1-4H3 |
| InChIKey | CMHGXZHWBKFDBO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|