C19H27NO3S — CID 24713399
1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 24713399) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 24713399 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | COCCCN(Cc1cccs1)CC(O)COc1ccccc1C |
| InChI | InChI=1S/C19H27NO3S/c1-16-7-3-4-9-19(16)23-15-17(21)13-20(10-6-11-22-2)14-18-8-5-12-24-18/h3-5,7-9,12,17,21H,6,10-11,13-15H2,1-2H3 |
| InChIKey | BXTYLSAJIWIXON-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|