C15H27NO3S — CID 93161338
(2R)-1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 93161338) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is (2R)-1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2R)-1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 93161338 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2R)-1-[3-methoxypropyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | COCCCN(Cc1cccs1)C[C@@H](O)COC(C)C |
| InChI | InChI=1S/C15H27NO3S/c1-13(2)19-12-14(17)10-16(7-5-8-18-3)11-15-6-4-9-20-15/h4,6,9,13-14,17H,5,7-8,10-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | OTSJDDYRYWTPBI-CQSZACIVSA-N |
| XLogP | 2.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|