C12H21NO2S — CID 129369879
(2R)-1-[methyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 129369879) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is (2R)-1-[methyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2R)-1-[methyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 129369879 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R)-1-[methyl(thiophen-2-ylmethyl)amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OC[C@H](O)CN(C)Cc1cccs1 |
| InChI | InChI=1S/C12H21NO2S/c1-10(2)15-9-11(14)7-13(3)8-12-5-4-6-16-12/h4-6,10-11,14H,7-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | QWTVIFNOISUKOO-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |