C11H19NOS — CID 106932766
(2S)-1-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-2-ol (PubChem CID 106932766) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is (2S)-1-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 106932766 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2S)-1-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-2-ol |
| SMILES | CC(C)N(Cc1cccs1)C[C@H](C)O |
| InChI | InChI=1S/C11H19NOS/c1-9(2)12(7-10(3)13)8-11-5-4-6-14-11/h4-6,9-10,13H,7-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | YFVWSDIHBHTGGK-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |