C12H19NO3S — CID 112509111
N,N-bis(2-hydroxypropyl)-2-thiophen-2-ylacetamide (PubChem CID 112509111) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is N,N-bis(2-hydroxypropyl)-2-thiophen-2-ylacetamide.
| Compound Name | N,N-bis(2-hydroxypropyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 112509111 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N,N-bis(2-hydroxypropyl)-2-thiophen-2-ylacetamide |
| SMILES | CC(O)CN(CC(C)O)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C12H19NO3S/c1-9(14)7-13(8-10(2)15)12(16)6-11-4-3-5-17-11/h3-5,9-10,14-15H,6-8H2,1-2H3 |
| InChIKey | NYQYFKXVLIHPJG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |