C10H15NO2S — CID 39243285
N-ethyl-N-(2-hydroxyethyl)-2-thiophen-2-ylacetamide (PubChem CID 39243285) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 39243285 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-2-thiophen-2-ylacetamide |
| SMILES | CCN(CCO)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C10H15NO2S/c1-2-11(5-6-12)10(13)8-9-4-3-7-14-9/h3-4,7,12H,2,5-6,8H2,1H3 |
| InChIKey | VVCIVTYAVRYGGM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |