C18H25NOS — CID 42701018
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-butyl-2-thiophen-2-ylacetamide (PubChem CID 42701018) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-butyl-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-butyl-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 42701018 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-butyl-2-thiophen-2-ylacetamide |
| SMILES | CCCCN(CC1CC2C=CC1C2)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C18H25NOS/c1-2-3-8-19(18(20)12-17-5-4-9-21-17)13-16-11-14-6-7-15(16)10-14/h4-7,9,14-16H,2-3,8,10-13H2,1H3 |
| InChIKey | QAPPKKWTWQJICL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|