C11H16ClNOS — CID 15063295
N-butyl-2-chloro-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 15063295) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is N-butyl-2-chloro-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-butyl-2-chloro-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 15063295 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-butyl-2-chloro-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCN(Cc1cccs1)C(=O)CCl |
| InChI | InChI=1S/C11H16ClNOS/c1-2-3-6-13(11(14)8-12)9-10-5-4-7-15-10/h4-5,7H,2-3,6,8-9H2,1H3 |
| InChIKey | GKMSSYXDLLSZNI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|