C17H22N2O3S2 — CID 118113458
2-[bis(thiophen-2-ylmethyl)carbamoyl-butylamino]acetic acid (PubChem CID 118113458) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-[bis(thiophen-2-ylmethyl)carbamoyl-butylamino]acetic acid.
| Compound Name | 2-[bis(thiophen-2-ylmethyl)carbamoyl-butylamino]acetic acid |
|---|---|
| PubChem CID | 118113458 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[bis(thiophen-2-ylmethyl)carbamoyl-butylamino]acetic acid |
| SMILES | CCCCN(CC(=O)O)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-2-3-8-18(13-16(20)21)17(22)19(11-14-6-4-9-23-14)12-15-7-5-10-24-15/h4-7,9-10H,2-3,8,11-13H2,1H3,(H,20,21) |
| InChIKey | JBWUYDSWZPKFME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |