C18H24N2O3S3 — CID 87946200
bis(thiophen-2-ylmethyl)carbamoylsulfanyl-[(2S)-hexan-2-yl]carbamic acid (PubChem CID 87946200) has the molecular formula C18H24N2O3S3 and a molecular weight of 412.60 g/mol. Its IUPAC name is bis(thiophen-2-ylmethyl)carbamoylsulfanyl-[(2S)-hexan-2-yl]carbamic acid.
| Compound Name | bis(thiophen-2-ylmethyl)carbamoylsulfanyl-[(2S)-hexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87946200 |
| Molecular Formula | C18H24N2O3S3 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | bis(thiophen-2-ylmethyl)carbamoylsulfanyl-[(2S)-hexan-2-yl]carbamic acid |
| SMILES | CCCC[C@H](C)N(SC(=O)N(Cc1cccs1)Cc1cccs1)C(=O)O |
| InChI | InChI=1S/C18H24N2O3S3/c1-3-4-7-14(2)20(17(21)22)26-18(23)19(12-15-8-5-10-24-15)13-16-9-6-11-25-16/h5-6,8-11,14H,3-4,7,12-13H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | MMNDCEFGVLIVRQ-AWEZNQCLSA-N |
| XLogP | 6.14 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|