C18H25N3O2S2 — CID 76534196
2-(methylcarbamoylamino)-N,N-bis(thiophen-2-ylmethyl)hexanamide (PubChem CID 76534196) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-(methylcarbamoylamino)-N,N-bis(thiophen-2-ylmethyl)hexanamide.
| Compound Name | 2-(methylcarbamoylamino)-N,N-bis(thiophen-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 76534196 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-(methylcarbamoylamino)-N,N-bis(thiophen-2-ylmethyl)hexanamide |
| SMILES | CCCCC(NC(=O)NC)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C18H25N3O2S2/c1-3-4-9-16(20-18(23)19-2)17(22)21(12-14-7-5-10-24-14)13-15-8-6-11-25-15/h5-8,10-11,16H,3-4,9,12-13H2,1-2H3,(H2,19,20,23) |
| InChIKey | PJROYUSTLBXFDU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |