C14H23NO2S — CID 112547960
methyl 2-[ethyl(thiophen-2-ylmethyl)amino]hexanoate (PubChem CID 112547960) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is methyl 2-[ethyl(thiophen-2-ylmethyl)amino]hexanoate.
| Compound Name | methyl 2-[ethyl(thiophen-2-ylmethyl)amino]hexanoate |
|---|---|
| PubChem CID | 112547960 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 2-[ethyl(thiophen-2-ylmethyl)amino]hexanoate |
| SMILES | CCCCC(C(=O)OC)N(CC)Cc1cccs1 |
| InChI | InChI=1S/C14H23NO2S/c1-4-6-9-13(14(16)17-3)15(5-2)11-12-8-7-10-18-12/h7-8,10,13H,4-6,9,11H2,1-3H3 |
| InChIKey | FDPAOBPLTCXQHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |