methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate

C15H25NO2S — CID 113373650

IUPACmethyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate
SMILESCCCCC(C(=O)OC)N(C)C(C)Cc1cccs1
InChIInChI=1S/C15H25NO2S/c1-5-6-9-14(15(17)18-4)16(3)12(2)11-13-8-7-10-19-13/h7-8,10,12,14H,5-6,9,11H2,1-4H3
InChIKeyHIIVIVSCCPGUMV-UHFFFAOYSA-N
MW283.44 g/mol
LogP3.34
Rot. Bonds8

About methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate

methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate (PubChem CID 113373650) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate.

Molecular Properties

Compound Namemethyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate
PubChem CID113373650
Molecular FormulaC15H25NO2S
Molecular Weight283.44 g/mol
Exact Mass283.16
IUPAC Namemethyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate
SMILESCCCCC(C(=O)OC)N(C)C(C)Cc1cccs1
InChIInChI=1S/C15H25NO2S/c1-5-6-9-14(15(17)18-4)16(3)12(2)11-13-8-7-10-19-13/h7-8,10,12,14H,5-6,9,11H2,1-4H3
InChIKeyHIIVIVSCCPGUMV-UHFFFAOYSA-N
XLogP3.34
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.44
LogP ≤ 53.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate?
The IUPAC name of methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate (CID 113373650) is methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate.
What is the SMILES notation for methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate?
The canonical SMILES for methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate is CCCCC(C(=O)OC)N(C)C(C)Cc1cccs1.
What is the InChIKey of methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate?
The InChIKey is HIIVIVSCCPGUMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c1-5-6-9-14(15(17)18-4)16(3)12(2)11-13-8-7-10-19-13/h7-8,10,12,14H,5-6,9,11H2,1-4H3.
What are the key properties of methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate?
methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate has a molecular weight of 283.44 g/mol, XLogP of 3.34, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]hexanoate is sourced from PubChem (CID 113373650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).