C12H21N3OS — CID 79494279
3-[methyl(1-thiophen-2-ylpropan-2-yl)amino]butanehydrazide (PubChem CID 79494279) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 3-[methyl(1-thiophen-2-ylpropan-2-yl)amino]butanehydrazide.
| Compound Name | 3-[methyl(1-thiophen-2-ylpropan-2-yl)amino]butanehydrazide |
|---|---|
| PubChem CID | 79494279 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[methyl(1-thiophen-2-ylpropan-2-yl)amino]butanehydrazide |
| SMILES | CC(CC(=O)NN)N(C)C(C)Cc1cccs1 |
| InChI | InChI=1S/C12H21N3OS/c1-9(7-11-5-4-6-17-11)15(3)10(2)8-12(16)14-13/h4-6,9-10H,7-8,13H2,1-3H3,(H,14,16) |
| InChIKey | MVOBUBMZBWUWJQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|