C18H25N3O2S2 — CID 163791117
methyl (2R)-2-[[amino-[bis(thiophen-2-ylmethyl)amino]methylidene]amino]hexanoate (PubChem CID 163791117) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is methyl (2R)-2-[[amino-[bis(thiophen-2-ylmethyl)amino]methylidene]amino]hexanoate.
| Compound Name | methyl (2R)-2-[[amino-[bis(thiophen-2-ylmethyl)amino]methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 163791117 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | methyl (2R)-2-[[amino-[bis(thiophen-2-ylmethyl)amino]methylidene]amino]hexanoate |
| SMILES | CCCC[C@@H](/N=C(\N)N(Cc1cccs1)Cc1cccs1)C(=O)OC |
| InChI | InChI=1S/C18H25N3O2S2/c1-3-4-9-16(17(22)23-2)20-18(19)21(12-14-7-5-10-24-14)13-15-8-6-11-25-15/h5-8,10-11,16H,3-4,9,12-13H2,1-2H3,(H2,19,20)/t16-/m1/s1 |
| InChIKey | MWUZPYXOPDQRLM-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|