C21H30N2O3S2 — CID 140616777
tert-butyl N-[(2R)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamate (PubChem CID 140616777) has the molecular formula C21H30N2O3S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 140616777 |
| Molecular Formula | C21H30N2O3S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | tert-butyl N-[(2R)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C21H30N2O3S2/c1-5-6-11-18(22-20(25)26-21(2,3)4)19(24)23(14-16-9-7-12-27-16)15-17-10-8-13-28-17/h7-10,12-13,18H,5-6,11,14-15H2,1-4H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | ZLQVKWFFYLUKJM-GOSISDBHSA-N |
| XLogP | 5.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |