C21H35N3O5S — CID 118113494
[(5S)-6-[butyl(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid (PubChem CID 118113494) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is [(5S)-6-[butyl(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid.
| Compound Name | [(5S)-6-[butyl(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 118113494 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [(5S)-6-[butyl(thiophen-2-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
| SMILES | CCCCN(Cc1cccs1)C(=O)[C@H](CCCCNC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N3O5S/c1-5-6-13-24(15-16-10-9-14-30-16)18(25)17(11-7-8-12-22-19(26)27)23-20(28)29-21(2,3)4/h9-10,14,17,22H,5-8,11-13,15H2,1-4H3,(H,23,28)(H,26,27)/t17-/m0/s1 |
| InChIKey | YCSMHBFCMVUIAE-KRWDZBQOSA-N |
| XLogP | 4.21 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|