C24H33N5O5 — CID 118113524
[(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid (PubChem CID 118113524) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid.
| Compound Name | [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 118113524 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [(5S)-6-[bis(pyridin-4-ylmethyl)amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)O)C(=O)N(Cc1ccncc1)Cc1ccncc1 |
| InChI | InChI=1S/C24H33N5O5/c1-24(2,3)34-23(33)28-20(6-4-5-11-27-22(31)32)21(30)29(16-18-7-12-25-13-8-18)17-19-9-14-26-15-10-19/h7-10,12-15,20,27H,4-6,11,16-17H2,1-3H3,(H,28,33)(H,31,32)/t20-/m0/s1 |
| InChIKey | KOXURWVBVXMEMJ-FQEVSTJZSA-N |
| XLogP | 3.34 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|