C37H47N3O7 — CID 138469574
tert-butyl N-[(5S)-6-[benzyl(2,2-dimethoxyethyl)amino]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexyl]carbamate (PubChem CID 138469574) has the molecular formula C37H47N3O7 and a molecular weight of 645.80 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-[benzyl(2,2-dimethoxyethyl)amino]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-[benzyl(2,2-dimethoxyethyl)amino]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 138469574 |
| Molecular Formula | C37H47N3O7 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | tert-butyl N-[(5S)-6-[benzyl(2,2-dimethoxyethyl)amino]-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexyl]carbamate |
| SMILES | COC(CN(Cc1ccccc1)C(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)OC |
| InChI | InChI=1S/C37H47N3O7/c1-37(2,3)47-35(42)38-22-14-13-21-32(34(41)40(24-33(44-4)45-5)23-26-15-7-6-8-16-26)39-36(43)46-25-31-29-19-11-9-17-27(29)28-18-10-12-20-30(28)31/h6-12,15-20,31-33H,13-14,21-25H2,1-5H3,(H,38,42)(H,39,43)/t32-/m0/s1 |
| InChIKey | GSXAXDYBOGESIP-YTTGMZPUSA-N |
| XLogP | 6.24 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|