C33H38N2O5S — CID 10393338
S-benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioate (PubChem CID 10393338) has the molecular formula C33H38N2O5S and a molecular weight of 574.74 g/mol. Its IUPAC name is S-benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioate.
| Compound Name | S-benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioate |
|---|---|
| PubChem CID | 10393338 |
| Molecular Formula | C33H38N2O5S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | S-benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanethioate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C33H38N2O5S/c1-33(2,3)40-31(37)34-20-12-11-19-29(30(36)41-22-23-13-5-4-6-14-23)35-32(38)39-21-28-26-17-9-7-15-24(26)25-16-8-10-18-27(25)28/h4-10,13-18,28-29H,11-12,19-22H2,1-3H3,(H,34,37)(H,35,38)/t29-/m0/s1 |
| InChIKey | IXMBZNIVUCSOMH-LJAQVGFWSA-N |
| XLogP | 7.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|