C44H58N4O9 — CID 175983364
tert-butyl (2R,4S)-2-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]octanoate (PubChem CID 175983364) has the molecular formula C44H58N4O9 and a molecular weight of 786.97 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]octanoate.
| Compound Name | tert-butyl (2R,4S)-2-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]octanoate |
|---|---|
| PubChem CID | 175983364 |
| Molecular Formula | C44H58N4O9 |
| Molecular Weight | 786.97 g/mol |
| Exact Mass | 786.42 |
| IUPAC Name | tert-butyl (2R,4S)-2-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-2-[4-(phenylmethoxycarbonylamino)butyl]octanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)[C@](N)(CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H58N4O9/c1-42(2,3)56-38(50)44(45,25-15-17-27-46-39(51)54-28-30-18-8-7-9-19-30)37(49)36(24-14-16-26-47-40(52)57-43(4,5)6)48-41(53)55-29-35-33-22-12-10-20-31(33)32-21-11-13-23-34(32)35/h7-13,18-23,35-36H,14-17,24-29,45H2,1-6H3,(H,46,51)(H,47,52)(H,48,53)/t36-,44+/m0/s1 |
| InChIKey | SZKSYOKHCINIFJ-RXQWJGKGSA-N |
| XLogP | 7.29 |
| TPSA | 184.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.97 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|