C38H46N2O8 — CID 59575430
(3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 59575430) has the molecular formula C38H46N2O8 and a molecular weight of 658.79 g/mol. Its IUPAC name is (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 59575430 |
| Molecular Formula | C38H46N2O8 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | (3-methyl-1-oxo-1-phenylmethoxybutan-2-yl) 6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)C(OC(=O)C(CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H46N2O8/c1-25(2)33(35(42)45-23-26-15-7-6-8-16-26)47-34(41)32(40-37(44)48-38(3,4)5)21-13-14-22-39-36(43)46-24-31-29-19-11-9-17-27(29)28-18-10-12-20-30(28)31/h6-12,15-20,25,31-33H,13-14,21-24H2,1-5H3,(H,39,43)(H,40,44) |
| InChIKey | XYNIHBPYYKODLN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|