C37H45N3O7 — CID 176768941
(4-methylphenyl)methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 176768941) has the molecular formula C37H45N3O7 and a molecular weight of 643.78 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (4-methylphenyl)methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 176768941 |
| Molecular Formula | C37H45N3O7 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | Cc1ccc(COC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)[C@@H](C)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H45N3O7/c1-24-17-19-26(20-18-24)22-45-34(42)32(16-10-11-21-38-35(43)47-37(3,4)5)40-33(41)25(2)39-36(44)46-23-31-29-14-8-6-12-27(29)28-13-7-9-15-30(28)31/h6-9,12-15,17-20,25,31-32H,10-11,16,21-23H2,1-5H3,(H,38,43)(H,39,44)(H,40,41)/t25-,32+/m1/s1 |
| InChIKey | CWQVOUTXDVSPBN-GOXGLGGOSA-N |
| XLogP | 6.15 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|