C37H44N2O8 — CID 56641150
tert-butyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxymethyl]benzoate (PubChem CID 56641150) has the molecular formula C37H44N2O8 and a molecular weight of 644.77 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxymethyl]benzoate.
| Compound Name | tert-butyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 56641150 |
| Molecular Formula | C37H44N2O8 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxymethyl]benzoate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H44N2O8/c1-36(2,3)46-32(40)25-19-17-24(18-20-25)22-44-33(41)31(16-11-21-38-34(42)47-37(4,5)6)39-35(43)45-23-30-28-14-9-7-12-26(28)27-13-8-10-15-29(27)30/h7-10,12-15,17-20,30-31H,11,16,21-23H2,1-6H3,(H,38,42)(H,39,43)/t31-/m0/s1 |
| InChIKey | BCOACVXFBDRMMT-HKBQPEDESA-N |
| XLogP | 6.90 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|