C31H31Cl3N2O6 — CID 164674535
(2,4,5-trichlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 164674535) has the molecular formula C31H31Cl3N2O6 and a molecular weight of 633.96 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (2,4,5-trichlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 164674535 |
| Molecular Formula | C31H31Cl3N2O6 |
| Molecular Weight | 633.96 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | (2,4,5-trichlorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C31H31Cl3N2O6/c1-31(2,3)42-29(38)35-14-8-13-26(28(37)41-27-16-24(33)23(32)15-25(27)34)36-30(39)40-17-22-20-11-6-4-9-18(20)19-10-5-7-12-21(19)22/h4-7,9-12,15-16,22,26H,8,13-14,17H2,1-3H3,(H,35,38)(H,36,39)/t26-/m0/s1 |
| InChIKey | LVMNNCVXFWQZNM-SANMLTNESA-N |
| XLogP | 7.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.96 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|