C33H34N4O7 — CID 102287885
tert-butyl N-[(4S)-5-[(1,3-dioxoisoindol-2-yl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate (PubChem CID 102287885) has the molecular formula C33H34N4O7 and a molecular weight of 598.66 g/mol. Its IUPAC name is tert-butyl N-[(4S)-5-[(1,3-dioxoisoindol-2-yl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-5-[(1,3-dioxoisoindol-2-yl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 102287885 |
| Molecular Formula | C33H34N4O7 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | tert-butyl N-[(4S)-5-[(1,3-dioxoisoindol-2-yl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C33H34N4O7/c1-33(2,3)44-31(41)34-18-10-17-27(28(38)36-37-29(39)24-15-8-9-16-25(24)30(37)40)35-32(42)43-19-26-22-13-6-4-11-20(22)21-12-5-7-14-23(21)26/h4-9,11-16,26-27H,10,17-19H2,1-3H3,(H,34,41)(H,35,42)(H,36,38)/t27-/m0/s1 |
| InChIKey | RENJDTFQONMMCA-MHZLTWQESA-N |
| XLogP | 4.53 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|