C32H36N2O6 — CID 57268577
benzyl N-[(3S)-1-ethoxy-7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate (PubChem CID 57268577) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is benzyl N-[(3S)-1-ethoxy-7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-ethoxy-7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 57268577 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | benzyl N-[(3S)-1-ethoxy-7-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxoheptan-3-yl]carbamate |
| SMILES | CCOCC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H36N2O6/c1-2-38-22-30(35)29(34-32(37)39-20-23-12-4-3-5-13-23)18-10-11-19-33-31(36)40-21-28-26-16-8-6-14-24(26)25-15-7-9-17-27(25)28/h3-9,12-17,28-29H,2,10-11,18-22H2,1H3,(H,33,36)(H,34,37)/t29-/m0/s1 |
| InChIKey | CWVXIUDQTNBGEW-LJAQVGFWSA-N |
| XLogP | 5.60 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|