C28H29N3O8S — CID 122581392
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[2-(phenylmethoxycarbonylamino)ethylamino]propane-1-sulfonic acid (PubChem CID 122581392) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[2-(phenylmethoxycarbonylamino)ethylamino]propane-1-sulfonic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[2-(phenylmethoxycarbonylamino)ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 122581392 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[2-(phenylmethoxycarbonylamino)ethylamino]propane-1-sulfonic acid |
| SMILES | O=C(NCCNC(=O)[C@H](CS(=O)(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C28H29N3O8S/c32-26(29-14-15-30-27(33)38-16-19-8-2-1-3-9-19)25(18-40(35,36)37)31-28(34)39-17-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-13,24-25H,14-18H2,(H,29,32)(H,30,33)(H,31,34)(H,35,36,37)/t25-/m0/s1 |
| InChIKey | PIGGVGXYTQZZEC-VWLOTQADSA-N |
| XLogP | 2.82 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|