C30H31N3O7 — CID 154451109
[6-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamic acid (PubChem CID 154451109) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is [6-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamic acid.
| Compound Name | [6-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamic acid |
|---|---|
| PubChem CID | 154451109 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | [6-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-5-(phenylmethoxycarbonylamino)hexyl]carbamic acid |
| SMILES | O=C(O)NCCCCC(NC(=O)OCc1ccccc1)C(=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H31N3O7/c34-27(26(16-8-9-17-31-28(35)36)32-29(37)39-18-20-10-2-1-3-11-20)33-30(38)40-19-25-23-14-6-4-12-21(23)22-13-5-7-15-24(22)25/h1-7,10-15,25-26,31H,8-9,16-19H2,(H,32,37)(H,35,36)(H,33,34,38) |
| InChIKey | DAZCHDUSUIESJC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|