C43H43N2O5P — CID 162412490
benzyl (2S)-6-(3-diphenylphosphanylpropanoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 162412490) has the molecular formula C43H43N2O5P and a molecular weight of 698.80 g/mol. Its IUPAC name is benzyl (2S)-6-(3-diphenylphosphanylpropanoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (2S)-6-(3-diphenylphosphanylpropanoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 162412490 |
| Molecular Formula | C43H43N2O5P |
| Molecular Weight | 698.80 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | benzyl (2S)-6-(3-diphenylphosphanylpropanoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | O=C(CCP(c1ccccc1)c1ccccc1)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C43H43N2O5P/c46-41(27-29-51(33-18-6-2-7-19-33)34-20-8-3-9-21-34)44-28-15-14-26-40(42(47)49-30-32-16-4-1-5-17-32)45-43(48)50-31-39-37-24-12-10-22-35(37)36-23-11-13-25-38(36)39/h1-13,16-25,39-40H,14-15,26-31H2,(H,44,46)(H,45,48)/t40-/m0/s1 |
| InChIKey | GYCGVDJOTQMEIM-FAIXQHPJSA-N |
| XLogP | 7.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.80 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|