C34H40N2O5 — CID 176659727
benzyl (2S)-4-(8-deuteriooctylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate (PubChem CID 176659727) has the molecular formula C34H40N2O5 and a molecular weight of 557.71 g/mol. Its IUPAC name is benzyl (2S)-4-(8-deuteriooctylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate.
| Compound Name | benzyl (2S)-4-(8-deuteriooctylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 176659727 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | benzyl (2S)-4-(8-deuteriooctylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
| SMILES | [2H]CCCCCCCCNC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H40N2O5/c1-2-3-4-5-6-14-21-35-32(37)22-31(33(38)40-23-25-15-8-7-9-16-25)36-34(39)41-24-30-28-19-12-10-17-26(28)27-18-11-13-20-29(27)30/h7-13,15-20,30-31H,2-6,14,21-24H2,1H3,(H,35,37)(H,36,39)/t31-/m0/s1/i1D |
| InChIKey | ATIVUZPMOMCTKL-FKCTWMLYSA-N |
| XLogP | 6.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|